About (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine
(3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine (PubChem CID 89053219) has the molecular formula C10H21NS
and a molecular weight of 187.35 g/mol. Its IUPAC name is (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine.
Molecular Properties
| Compound Name | (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine |
| PubChem CID | 89053219 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine |
| SMILES | C=C(C)[C@H](CCSC)N(C)CC |
| InChI | InChI=1S/C10H21NS/c1-6-11(4)10(9(2)3)7-8-12-5/h10H,2,6-8H2,1,3-5H3/t10-/m0/s1 |
| InChIKey | QEKVNDWDGHFJCA-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine?
The IUPAC name of (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine (CID 89053219) is (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine.
What is the SMILES notation for (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine?
The canonical SMILES for (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine is C=C(C)[C@H](CCSC)N(C)CC.
What is the InChIKey of (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine?
The InChIKey is QEKVNDWDGHFJCA-JTQLQIEISA-N. The full InChI is InChI=1S/C10H21NS/c1-6-11(4)10(9(2)3)7-8-12-5/h10H,2,6-8H2,1,3-5H3/t10-/m0/s1.
What are the key properties of (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine?
(3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine has a molecular weight of 187.35 g/mol, XLogP of 2.64, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-ethyl-N,2-dimethyl-5-methylsulfanylpent-1-en-3-amine is sourced from PubChem (CID 89053219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).