About 3-ethynyl-5-methyl-1,2-thiazole
3-ethynyl-5-methyl-1,2-thiazole (PubChem CID 89053236) has the molecular formula C6H5NS
and a molecular weight of 123.18 g/mol. Its IUPAC name is 3-ethynyl-5-methyl-1,2-thiazole.
Molecular Properties
| Compound Name | 3-ethynyl-5-methyl-1,2-thiazole |
| PubChem CID | 89053236 |
| Molecular Formula | C6H5NS |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | 3-ethynyl-5-methyl-1,2-thiazole |
| SMILES | C#Cc1cc(C)sn1 |
| InChI | InChI=1S/C6H5NS/c1-3-6-4-5(2)8-7-6/h1,4H,2H3 |
| InChIKey | ZSAVRLOKYLRFAO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-5-methyl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-5-methyl-1,2-thiazole?
The IUPAC name of 3-ethynyl-5-methyl-1,2-thiazole (CID 89053236) is 3-ethynyl-5-methyl-1,2-thiazole.
What is the SMILES notation for 3-ethynyl-5-methyl-1,2-thiazole?
The canonical SMILES for 3-ethynyl-5-methyl-1,2-thiazole is C#Cc1cc(C)sn1.
What is the InChIKey of 3-ethynyl-5-methyl-1,2-thiazole?
The InChIKey is ZSAVRLOKYLRFAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NS/c1-3-6-4-5(2)8-7-6/h1,4H,2H3.
What are the key properties of 3-ethynyl-5-methyl-1,2-thiazole?
3-ethynyl-5-methyl-1,2-thiazole has a molecular weight of 123.18 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-5-methyl-1,2-thiazole is sourced from PubChem (CID 89053236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).