About 2-ethynyl-1,5-dimethylimidazole
2-ethynyl-1,5-dimethylimidazole (PubChem CID 89053263) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 2-ethynyl-1,5-dimethylimidazole.
Molecular Properties
| Compound Name | 2-ethynyl-1,5-dimethylimidazole |
| PubChem CID | 89053263 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 2-ethynyl-1,5-dimethylimidazole |
| SMILES | C#Cc1ncc(C)n1C |
| InChI | InChI=1S/C7H8N2/c1-4-7-8-5-6(2)9(7)3/h1,5H,2-3H3 |
| InChIKey | WJJMFSRECVXKQO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-1,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-1,5-dimethylimidazole?
The IUPAC name of 2-ethynyl-1,5-dimethylimidazole (CID 89053263) is 2-ethynyl-1,5-dimethylimidazole.
What is the SMILES notation for 2-ethynyl-1,5-dimethylimidazole?
The canonical SMILES for 2-ethynyl-1,5-dimethylimidazole is C#Cc1ncc(C)n1C.
What is the InChIKey of 2-ethynyl-1,5-dimethylimidazole?
The InChIKey is WJJMFSRECVXKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-4-7-8-5-6(2)9(7)3/h1,5H,2-3H3.
What are the key properties of 2-ethynyl-1,5-dimethylimidazole?
2-ethynyl-1,5-dimethylimidazole has a molecular weight of 120.15 g/mol, XLogP of 0.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-1,5-dimethylimidazole is sourced from PubChem (CID 89053263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).