C21H24ClFN2O3 — CID 89053348
3-(2-amino-4-chlorophenoxy)-1-[2-[(4-fluorophenyl)methyl]-1,4-oxazepan-4-yl]propan-1-one (PubChem CID 89053348) has the molecular formula C21H24ClFN2O3 and a molecular weight of 406.89 g/mol. Its IUPAC name is 3-(2-amino-4-chlorophenoxy)-1-[2-[(4-fluorophenyl)methyl]-1,4-oxazepan-4-yl]propan-1-one.
| Compound Name | 3-(2-amino-4-chlorophenoxy)-1-[2-[(4-fluorophenyl)methyl]-1,4-oxazepan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 89053348 |
| Molecular Formula | C21H24ClFN2O3 |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-(2-amino-4-chlorophenoxy)-1-[2-[(4-fluorophenyl)methyl]-1,4-oxazepan-4-yl]propan-1-one |
| SMILES | Nc1cc(Cl)ccc1OCCC(=O)N1CCCOC(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H24ClFN2O3/c22-16-4-7-20(19(24)13-16)28-11-8-21(26)25-9-1-10-27-18(14-25)12-15-2-5-17(23)6-3-15/h2-7,13,18H,1,8-12,14,24H2 |
| InChIKey | UOCICSBGGZVLIN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|