About 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid
3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid (PubChem CID 89053468) has the molecular formula C13H20N2O3S
and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid |
| PubChem CID | 89053468 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNCCC1CNc2ccccc21 |
| InChI | InChI=1S/C13H20N2O3S/c16-19(17,18)9-3-7-14-8-6-11-10-15-13-5-2-1-4-12(11)13/h1-2,4-5,11,14-15H,3,6-10H2,(H,16,17,18) |
| InChIKey | NXBWTJCMJFIKMV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid?
The IUPAC name of 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid (CID 89053468) is 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid.
What is the SMILES notation for 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid?
The canonical SMILES for 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid is O=S(=O)(O)CCCNCCC1CNc2ccccc21.
What is the InChIKey of 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid?
The InChIKey is NXBWTJCMJFIKMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3S/c16-19(17,18)9-3-7-14-8-6-11-10-15-13-5-2-1-4-12(11)13/h1-2,4-5,11,14-15H,3,6-10H2,(H,16,17,18).
What are the key properties of 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid?
3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid has a molecular weight of 284.38 g/mol, XLogP of 1.45, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]propane-1-sulfonic acid is sourced from PubChem (CID 89053468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).