C14H19N3 — CID 89053476
(1Z,3Z)-5-(3-methyl-1,2,6,7-tetrahydrobenzimidazol-2-yl)hexa-1,3,5-trien-1-amine (PubChem CID 89053476) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is (1Z,3Z)-5-(3-methyl-1,2,6,7-tetrahydrobenzimidazol-2-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-5-(3-methyl-1,2,6,7-tetrahydrobenzimidazol-2-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89053476 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (1Z,3Z)-5-(3-methyl-1,2,6,7-tetrahydrobenzimidazol-2-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C\C=C/N)C1NC2=C(C=CCC2)N1C |
| InChI | InChI=1S/C14H19N3/c1-11(7-5-6-10-15)14-16-12-8-3-4-9-13(12)17(14)2/h4-7,9-10,14,16H,1,3,8,15H2,2H3/b7-5-,10-6- |
| InChIKey | WXUYAGQCCWASPG-FWXHXWNTSA-N |
| XLogP | 1.99 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|