C15H20N2 — CID 89053548
(7Z)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methyl-4-methylidene-5,6-dihydro-1,3-diazocine (PubChem CID 89053548) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (7Z)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methyl-4-methylidene-5,6-dihydro-1,3-diazocine.
| Compound Name | (7Z)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methyl-4-methylidene-5,6-dihydro-1,3-diazocine |
|---|---|
| PubChem CID | 89053548 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (7Z)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methyl-4-methylidene-5,6-dihydro-1,3-diazocine |
| SMILES | C=C1CC/C=C\N(C)/C(C(=C)/C=C\C=C/C)=N\1 |
| InChI | InChI=1S/C15H20N2/c1-5-6-7-10-13(2)15-16-14(3)11-8-9-12-17(15)4/h5-7,9-10,12H,2-3,8,11H2,1,4H3/b6-5-,10-7-,12-9-,16-15- |
| InChIKey | AQILPZATUCMWTM-WDWNXTKKSA-N |
| XLogP | 3.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|