About 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine
2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine (PubChem CID 89053730) has the molecular formula C12H18ClFN4
and a molecular weight of 272.75 g/mol. Its IUPAC name is 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine |
| PubChem CID | 89053730 |
| Molecular Formula | C12H18ClFN4 |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine |
| SMILES | CC1CCC(CCNc2nc(Cl)ncc2F)N1C |
| InChI | InChI=1S/C12H18ClFN4/c1-8-3-4-9(18(8)2)5-6-15-11-10(14)7-16-12(13)17-11/h7-9H,3-6H2,1-2H3,(H,15,16,17) |
| InChIKey | FXEQNWJCQFKKRO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine?
The IUPAC name of 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine (CID 89053730) is 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine?
The canonical SMILES for 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine is CC1CCC(CCNc2nc(Cl)ncc2F)N1C.
What is the InChIKey of 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine?
The InChIKey is FXEQNWJCQFKKRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClFN4/c1-8-3-4-9(18(8)2)5-6-15-11-10(14)7-16-12(13)17-11/h7-9H,3-6H2,1-2H3,(H,15,16,17).
What are the key properties of 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine?
2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine has a molecular weight of 272.75 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[2-(1,5-dimethylpyrrolidin-2-yl)ethyl]-5-fluoropyrimidin-4-amine is sourced from PubChem (CID 89053730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).