About N-ethyl-N,3-dimethylpentan-2-amine
N-ethyl-N,3-dimethylpentan-2-amine (PubChem CID 89053898) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is N-ethyl-N,3-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-N,3-dimethylpentan-2-amine |
| PubChem CID | 89053898 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | N-ethyl-N,3-dimethylpentan-2-amine |
| SMILES | CCC(C)C(C)N(C)CC |
| InChI | InChI=1S/C9H21N/c1-6-8(3)9(4)10(5)7-2/h8-9H,6-7H2,1-5H3 |
| InChIKey | AEPMKPNDKGYMJY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-N,3-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N,3-dimethylpentan-2-amine?
The IUPAC name of N-ethyl-N,3-dimethylpentan-2-amine (CID 89053898) is N-ethyl-N,3-dimethylpentan-2-amine.
What is the SMILES notation for N-ethyl-N,3-dimethylpentan-2-amine?
The canonical SMILES for N-ethyl-N,3-dimethylpentan-2-amine is CCC(C)C(C)N(C)CC.
What is the InChIKey of N-ethyl-N,3-dimethylpentan-2-amine?
The InChIKey is AEPMKPNDKGYMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N/c1-6-8(3)9(4)10(5)7-2/h8-9H,6-7H2,1-5H3.
What are the key properties of N-ethyl-N,3-dimethylpentan-2-amine?
N-ethyl-N,3-dimethylpentan-2-amine has a molecular weight of 143.27 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N,3-dimethylpentan-2-amine is sourced from PubChem (CID 89053898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).