C37H29F3N2O4S — CID 89053924
3-(9H-fluoren-9-ylmethyl)-5-[(1R)-5-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 89053924) has the molecular formula C37H29F3N2O4S and a molecular weight of 654.71 g/mol. Its IUPAC name is 3-(9H-fluoren-9-ylmethyl)-5-[(1R)-5-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(9H-fluoren-9-ylmethyl)-5-[(1R)-5-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89053924 |
| Molecular Formula | C37H29F3N2O4S |
| Molecular Weight | 654.71 g/mol |
| Exact Mass | 654.18 |
| IUPAC Name | 3-(9H-fluoren-9-ylmethyl)-5-[(1R)-5-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1c2ccccc2C(Oc2ccc3c(c2)CC[C@H]3C2SC(=O)N(CC3c4ccccc4-c4ccccc43)C2=O)CN1CC(F)(F)F |
| InChI | InChI=1S/C37H29F3N2O4S/c38-37(39,40)20-41-19-32(28-11-5-6-12-30(28)34(41)43)46-22-14-16-23-21(17-22)13-15-29(23)33-35(44)42(36(45)47-33)18-31-26-9-3-1-7-24(26)25-8-2-4-10-27(25)31/h1-12,14,16-17,29,31-33H,13,15,18-20H2/t29-,32?,33?/m1/s1 |
| InChIKey | RVOUZEJJMVWTFJ-DFLARTOCSA-N |
| XLogP | 7.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.71 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|