C33H34FN5OS — CID 89054001
5-[(2-fluorophenyl)methyl]-N-[3-(4-phenylpiperazin-1-yl)propyl]-6-sulfanylidene-8H-pyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 89054001) has the molecular formula C33H34FN5OS and a molecular weight of 567.73 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-N-[3-(4-phenylpiperazin-1-yl)propyl]-6-sulfanylidene-8H-pyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | 5-[(2-fluorophenyl)methyl]-N-[3-(4-phenylpiperazin-1-yl)propyl]-6-sulfanylidene-8H-pyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 89054001 |
| Molecular Formula | C33H34FN5OS |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-N-[3-(4-phenylpiperazin-1-yl)propyl]-6-sulfanylidene-8H-pyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2)CC1)c1ccc2c(c1)N(Cc1ccccc1F)C(=S)C1=CCC=CN12 |
| InChI | InChI=1S/C33H34FN5OS/c34-28-12-5-4-9-26(28)24-39-31-23-25(14-15-29(31)38-18-7-6-13-30(38)33(39)41)32(40)35-16-8-17-36-19-21-37(22-20-36)27-10-2-1-3-11-27/h1-5,7,9-15,18,23H,6,8,16-17,19-22,24H2,(H,35,40) |
| InChIKey | OPXOXXIZLWDDBG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|