About N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide
N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide (PubChem CID 89054004) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide |
| PubChem CID | 89054004 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide |
| SMILES | CC(=O)Nc1cc(C(C)C)no1 |
| InChI | InChI=1S/C8H12N2O2/c1-5(2)7-4-8(12-10-7)9-6(3)11/h4-5H,1-3H3,(H,9,11) |
| InChIKey | XGKCXKHEFDCTIQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
The IUPAC name of N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide (CID 89054004) is N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide.
What is the SMILES notation for N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
The canonical SMILES for N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide is CC(=O)Nc1cc(C(C)C)no1.
What is the InChIKey of N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
The InChIKey is XGKCXKHEFDCTIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5(2)7-4-8(12-10-7)9-6(3)11/h4-5H,1-3H3,(H,9,11).
What are the key properties of N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide has a molecular weight of 168.20 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide is sourced from PubChem (CID 89054004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).