C23H21N5O3 — CID 89054047
2-(4-aminophenyl)-7-(morpholine-4-carbonyl)-5H-pyrido[3,2-b]indole-4-carboxamide (PubChem CID 89054047) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-(4-aminophenyl)-7-(morpholine-4-carbonyl)-5H-pyrido[3,2-b]indole-4-carboxamide.
| Compound Name | 2-(4-aminophenyl)-7-(morpholine-4-carbonyl)-5H-pyrido[3,2-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 89054047 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-(4-aminophenyl)-7-(morpholine-4-carbonyl)-5H-pyrido[3,2-b]indole-4-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(N)cc2)nc2c1[nH]c1cc(C(=O)N3CCOCC3)ccc12 |
| InChI | InChI=1S/C23H21N5O3/c24-15-4-1-13(2-5-15)18-12-17(22(25)29)21-20(26-18)16-6-3-14(11-19(16)27-21)23(30)28-7-9-31-10-8-28/h1-6,11-12,27H,7-10,24H2,(H2,25,29) |
| InChIKey | ZEQTWAMSJMJBET-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|