C31H35N5O2 — CID 89054137
6-[3-(1-aminoethenyl)phenyl]-2-[[3-[C-methyl-N-[(1E)-2-(piperidin-4-ylmethoxy)buta-1,3-dienyl]carbonimidoyl]phenyl]methyl]pyridazin-3-one (PubChem CID 89054137) has the molecular formula C31H35N5O2 and a molecular weight of 509.65 g/mol. Its IUPAC name is 6-[3-(1-aminoethenyl)phenyl]-2-[[3-[C-methyl-N-[(1E)-2-(piperidin-4-ylmethoxy)buta-1,3-dienyl]carbonimidoyl]phenyl]methyl]pyridazin-3-one.
| Compound Name | 6-[3-(1-aminoethenyl)phenyl]-2-[[3-[C-methyl-N-[(1E)-2-(piperidin-4-ylmethoxy)buta-1,3-dienyl]carbonimidoyl]phenyl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 89054137 |
| Molecular Formula | C31H35N5O2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 6-[3-(1-aminoethenyl)phenyl]-2-[[3-[C-methyl-N-[(1E)-2-(piperidin-4-ylmethoxy)buta-1,3-dienyl]carbonimidoyl]phenyl]methyl]pyridazin-3-one |
| SMILES | C=C/C(=C\N=C(/C)c1cccc(Cn2nc(-c3cccc(C(=C)N)c3)ccc2=O)c1)OCC1CCNCC1 |
| InChI | InChI=1S/C31H35N5O2/c1-4-29(38-21-24-13-15-33-16-14-24)19-34-23(3)27-9-5-7-25(17-27)20-36-31(37)12-11-30(35-36)28-10-6-8-26(18-28)22(2)32/h4-12,17-19,24,33H,1-2,13-16,20-21,32H2,3H3/b29-19+,34-23+ |
| InChIKey | DWOBAEQOIKYOSL-POJSDSRVSA-N |
| XLogP | 4.74 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|