C18H24F3IN4O2 — CID 89054276
(2S)-1-[(2Z,4E)-5-amino-1-iodo-4-(trifluoromethyl)penta-2,4-dienyl]-N-(5-tert-butyl-1,2-oxazol-3-yl)pyrrolidine-2-carboxamide (PubChem CID 89054276) has the molecular formula C18H24F3IN4O2 and a molecular weight of 512.31 g/mol. Its IUPAC name is (2S)-1-[(2Z,4E)-5-amino-1-iodo-4-(trifluoromethyl)penta-2,4-dienyl]-N-(5-tert-butyl-1,2-oxazol-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2Z,4E)-5-amino-1-iodo-4-(trifluoromethyl)penta-2,4-dienyl]-N-(5-tert-butyl-1,2-oxazol-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89054276 |
| Molecular Formula | C18H24F3IN4O2 |
| Molecular Weight | 512.31 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | (2S)-1-[(2Z,4E)-5-amino-1-iodo-4-(trifluoromethyl)penta-2,4-dienyl]-N-(5-tert-butyl-1,2-oxazol-3-yl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)[C@@H]2CCCN2C(I)/C=C\C(=C/N)C(F)(F)F)no1 |
| InChI | InChI=1S/C18H24F3IN4O2/c1-17(2,3)13-9-15(25-28-13)24-16(27)12-5-4-8-26(12)14(22)7-6-11(10-23)18(19,20)21/h6-7,9-10,12,14H,4-5,8,23H2,1-3H3,(H,24,25,27)/b7-6-,11-10-/t12-,14?/m0/s1 |
| InChIKey | KLCHYQDKXBFEKH-AQWQFORJSA-N |
| XLogP | 4.10 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|