About [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate
[4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate (PubChem CID 89054418) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate.
Molecular Properties
| Compound Name | [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate |
| PubChem CID | 89054418 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate |
| SMILES | [H]/N=C(\CC)OC1C=CC(CNCCC(C)C)=CC1 |
| InChI | InChI=1S/C15H26N2O/c1-4-15(16)18-14-7-5-13(6-8-14)11-17-10-9-12(2)3/h5-7,12,14,16-17H,4,8-11H2,1-3H3/b16-15+ |
| InChIKey | UUNHXUXZOYNNCJ-FOCLMDBBSA-N |
| XLogP | 3.28 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate?
The IUPAC name of [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate (CID 89054418) is [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate.
What is the SMILES notation for [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate?
The canonical SMILES for [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate is [H]/N=C(\CC)OC1C=CC(CNCCC(C)C)=CC1.
What is the InChIKey of [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate?
The InChIKey is UUNHXUXZOYNNCJ-FOCLMDBBSA-N. The full InChI is InChI=1S/C15H26N2O/c1-4-15(16)18-14-7-5-13(6-8-14)11-17-10-9-12(2)3/h5-7,12,14,16-17H,4,8-11H2,1-3H3/b16-15+.
What are the key properties of [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate?
[4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate has a molecular weight of 250.39 g/mol, XLogP of 3.28, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3-methylbutylamino)methyl]cyclohexa-2,4-dien-1-yl] propanimidate is sourced from PubChem (CID 89054418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).