C22H19F3N4S — CID 89054610
N-[3-[6-(1,1-difluoroethyl)-3-pyridinyl]propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine (PubChem CID 89054610) has the molecular formula C22H19F3N4S and a molecular weight of 428.48 g/mol. Its IUPAC name is N-[3-[6-(1,1-difluoroethyl)-3-pyridinyl]propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine.
| Compound Name | N-[3-[6-(1,1-difluoroethyl)-3-pyridinyl]propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 89054610 |
| Molecular Formula | C22H19F3N4S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[3-[6-(1,1-difluoroethyl)-3-pyridinyl]propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine |
| SMILES | CC(F)(F)c1ccc(CCCNc2ncc(-c3ccc4cnc(F)cc4c3)s2)cn1 |
| InChI | InChI=1S/C22H19F3N4S/c1-22(24,25)19-7-4-14(11-27-19)3-2-8-26-21-29-13-18(30-21)15-5-6-16-12-28-20(23)10-17(16)9-15/h4-7,9-13H,2-3,8H2,1H3,(H,26,29) |
| InChIKey | MZCKZLZERZWESB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|