About 2,3-diethyl-1,3-thiazolidine
2,3-diethyl-1,3-thiazolidine (PubChem CID 89054690) has the molecular formula C7H15NS
and a molecular weight of 145.27 g/mol. Its IUPAC name is 2,3-diethyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2,3-diethyl-1,3-thiazolidine |
| PubChem CID | 89054690 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2,3-diethyl-1,3-thiazolidine |
| SMILES | CCC1SCCN1CC |
| InChI | InChI=1S/C7H15NS/c1-3-7-8(4-2)5-6-9-7/h7H,3-6H2,1-2H3 |
| InChIKey | YNZQUTNBBQVMSQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-diethyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethyl-1,3-thiazolidine?
The IUPAC name of 2,3-diethyl-1,3-thiazolidine (CID 89054690) is 2,3-diethyl-1,3-thiazolidine.
What is the SMILES notation for 2,3-diethyl-1,3-thiazolidine?
The canonical SMILES for 2,3-diethyl-1,3-thiazolidine is CCC1SCCN1CC.
What is the InChIKey of 2,3-diethyl-1,3-thiazolidine?
The InChIKey is YNZQUTNBBQVMSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NS/c1-3-7-8(4-2)5-6-9-7/h7H,3-6H2,1-2H3.
What are the key properties of 2,3-diethyl-1,3-thiazolidine?
2,3-diethyl-1,3-thiazolidine has a molecular weight of 145.27 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethyl-1,3-thiazolidine is sourced from PubChem (CID 89054690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).