C70H46N6 — CID 89055073
4-[3-[3-[9-[(3E)-hexa-1,3,5-trien-3-yl]-2,7-diphenylpyrido[3,2-h]quinazolin-4-yl]phenyl]phenyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline (PubChem CID 89055073) has the molecular formula C70H46N6 and a molecular weight of 971.18 g/mol. Its IUPAC name is 4-[3-[3-[9-[(3E)-hexa-1,3,5-trien-3-yl]-2,7-diphenylpyrido[3,2-h]quinazolin-4-yl]phenyl]phenyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline.
| Compound Name | 4-[3-[3-[9-[(3E)-hexa-1,3,5-trien-3-yl]-2,7-diphenylpyrido[3,2-h]quinazolin-4-yl]phenyl]phenyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline |
|---|---|
| PubChem CID | 89055073 |
| Molecular Formula | C70H46N6 |
| Molecular Weight | 971.18 g/mol |
| Exact Mass | 970.38 |
| IUPAC Name | 4-[3-[3-[9-[(3E)-hexa-1,3,5-trien-3-yl]-2,7-diphenylpyrido[3,2-h]quinazolin-4-yl]phenyl]phenyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline |
| SMILES | C=C/C=C(\C=C)c1cc(-c2ccccc2)c2ccc3c(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc7c6ccc6c(-c8ccccc8)cc(-c8ccccc8)nc67)c5)c4)nc(-c4ccccc4)nc3c2n1 |
| InChI | InChI=1S/C70H46N6/c1-3-22-45(4-2)61-43-59(46-23-10-5-11-24-46)55-37-39-57-63(73-69(49-29-16-8-17-30-49)75-67(57)65(55)71-61)53-35-20-33-51(41-53)52-34-21-36-54(42-52)64-58-40-38-56-60(47-25-12-6-13-26-47)44-62(48-27-14-7-15-28-48)72-66(56)68(58)76-70(74-64)50-31-18-9-19-32-50/h3-44H,1-2H2/b45-22+ |
| InChIKey | KHGZTZYLXDYQJM-FZKLNCOPSA-N |
| XLogP | 17.76 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.18 |
| LogP ≤ 5 | 17.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|