C29H50N4O2 — CID 89056324
(E,4E)-4-[(Z)-but-2-enylidene]-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)pent-2-enediamide (PubChem CID 89056324) has the molecular formula C29H50N4O2 and a molecular weight of 486.75 g/mol. Its IUPAC name is (E,4E)-4-[(Z)-but-2-enylidene]-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)pent-2-enediamide.
| Compound Name | (E,4E)-4-[(Z)-but-2-enylidene]-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)pent-2-enediamide |
|---|---|
| PubChem CID | 89056324 |
| Molecular Formula | C29H50N4O2 |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.39 |
| IUPAC Name | (E,4E)-4-[(Z)-but-2-enylidene]-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)pent-2-enediamide |
| SMILES | C/C=C\C=C(/C=C/C(=O)NC1CC(C)(C)N(C)C(C)(C)C1)C(=O)NC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C29H50N4O2/c1-12-13-14-21(25(35)31-23-19-28(6,7)33(11)29(8,9)20-23)15-16-24(34)30-22-17-26(2,3)32(10)27(4,5)18-22/h12-16,22-23H,17-20H2,1-11H3,(H,30,34)(H,31,35)/b13-12-,16-15+,21-14+ |
| InChIKey | DTNPNOOSIFMPCW-SVGRAMASSA-N |
| XLogP | 4.58 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|