About [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone
[5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 89056801) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 89056801 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CNc1cnc(C(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C9H13N3O2/c1-10-7-6-11-8(14-7)9(13)12-4-2-3-5-12/h6,10H,2-5H2,1H3 |
| InChIKey | RCJCYOXZPKFHOE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone (CID 89056801) is [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone is CNc1cnc(C(=O)N2CCCC2)o1.
What is the InChIKey of [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone?
The InChIKey is RCJCYOXZPKFHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-10-7-6-11-8(14-7)9(13)12-4-2-3-5-12/h6,10H,2-5H2,1H3.
What are the key properties of [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone?
[5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone has a molecular weight of 195.22 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(methylamino)-1,3-oxazol-2-yl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 89056801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).