About azanylidynecobalt;N-phenylethanimine
azanylidynecobalt;N-phenylethanimine (PubChem CID 89057031) has the molecular formula C8H8CoN2-
and a molecular weight of 191.10 g/mol. Its IUPAC name is azanylidynecobalt;N-phenylethanimine.
Molecular Properties
| Compound Name | azanylidynecobalt;N-phenylethanimine |
| PubChem CID | 89057031 |
| Molecular Formula | C8H8CoN2- |
| Molecular Weight | 191.10 g/mol |
| Exact Mass | 191.00 |
| IUPAC Name | azanylidynecobalt;N-phenylethanimine |
| SMILES | C/C=N/c1cc[c-]cc1.N#[Co] |
| InChI | InChI=1S/C8H8N.Co.N/c1-2-9-8-6-4-3-5-7-8;;/h2,4-7H,1H3;;/q-1;;/b9-2+;; |
| InChIKey | JOJOCHKQEKODBI-VFXUXTATSA-N |
| XLogP | 2.22 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.10 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze azanylidynecobalt;N-phenylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanylidynecobalt;N-phenylethanimine?
The IUPAC name of azanylidynecobalt;N-phenylethanimine (CID 89057031) is azanylidynecobalt;N-phenylethanimine.
What is the SMILES notation for azanylidynecobalt;N-phenylethanimine?
The canonical SMILES for azanylidynecobalt;N-phenylethanimine is C/C=N/c1cc[c-]cc1.N#[Co].
What is the InChIKey of azanylidynecobalt;N-phenylethanimine?
The InChIKey is JOJOCHKQEKODBI-VFXUXTATSA-N. The full InChI is InChI=1S/C8H8N.Co.N/c1-2-9-8-6-4-3-5-7-8;;/h2,4-7H,1H3;;/q-1;;/b9-2+;;.
What are the key properties of azanylidynecobalt;N-phenylethanimine?
azanylidynecobalt;N-phenylethanimine has a molecular weight of 191.10 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidynecobalt;N-phenylethanimine is sourced from PubChem (CID 89057031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).