C26H27NO5 — CID 89057186
oxan-2-ylmethyl 2-[5-hydroxy-2-methyl-1-[(E)-3-phenylprop-2-enoyl]indol-3-yl]acetate (PubChem CID 89057186) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is oxan-2-ylmethyl 2-[5-hydroxy-2-methyl-1-[(E)-3-phenylprop-2-enoyl]indol-3-yl]acetate.
| Compound Name | oxan-2-ylmethyl 2-[5-hydroxy-2-methyl-1-[(E)-3-phenylprop-2-enoyl]indol-3-yl]acetate |
|---|---|
| PubChem CID | 89057186 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | oxan-2-ylmethyl 2-[5-hydroxy-2-methyl-1-[(E)-3-phenylprop-2-enoyl]indol-3-yl]acetate |
| SMILES | Cc1c(CC(=O)OCC2CCCCO2)c2cc(O)ccc2n1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H27NO5/c1-18-22(16-26(30)32-17-21-9-5-6-14-31-21)23-15-20(28)11-12-24(23)27(18)25(29)13-10-19-7-3-2-4-8-19/h2-4,7-8,10-13,15,21,28H,5-6,9,14,16-17H2,1H3/b13-10+ |
| InChIKey | LUQXHZXWFAXTIU-JLHYYAGUSA-N |
| XLogP | 4.66 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|