C28H48O2Si — CID 89057209
(2S)-2-[(4E,7aR)-4-[(2E)-2-[(5S)-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propan-1-ol (PubChem CID 89057209) has the molecular formula C28H48O2Si and a molecular weight of 444.78 g/mol. Its IUPAC name is (2S)-2-[(4E,7aR)-4-[(2E)-2-[(5S)-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propan-1-ol.
| Compound Name | (2S)-2-[(4E,7aR)-4-[(2E)-2-[(5S)-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 89057209 |
| Molecular Formula | C28H48O2Si |
| Molecular Weight | 444.78 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | (2S)-2-[(4E,7aR)-4-[(2E)-2-[(5S)-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propan-1-ol |
| SMILES | C=C1CC[C@H](CC(C)(C)[Si](C)(C)O)C/C1=C\C=C1/CCC[C@@]2(C)C1CCC2[C@H](C)CO |
| InChI | InChI=1S/C28H48O2Si/c1-20-10-11-22(18-27(3,4)31(6,7)30)17-24(20)13-12-23-9-8-16-28(5)25(21(2)19-29)14-15-26(23)28/h12-13,21-22,25-26,29-30H,1,8-11,14-19H2,2-7H3/b23-12+,24-13+/t21-,22+,25?,26?,28-/m1/s1 |
| InChIKey | QTQMQGRREQEGFQ-VPTXEXFTSA-N |
| XLogP | 7.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.78 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|