About (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile
(2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile (PubChem CID 89057244) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile |
| PubChem CID | 89057244 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile |
| SMILES | C=C(/C=C\C(C#N)=C/C)NCCN |
| InChI | InChI=1S/C10H15N3/c1-3-10(8-12)5-4-9(2)13-7-6-11/h3-5,13H,2,6-7,11H2,1H3/b5-4-,10-3+ |
| InChIKey | CLHDGYIFZHBTMB-MZTCIMCMSA-N |
| XLogP | 1.07 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile?
The IUPAC name of (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile (CID 89057244) is (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile.
What is the SMILES notation for (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile?
The canonical SMILES for (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile is C=C(/C=C\C(C#N)=C/C)NCCN.
What is the InChIKey of (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile?
The InChIKey is CLHDGYIFZHBTMB-MZTCIMCMSA-N. The full InChI is InChI=1S/C10H15N3/c1-3-10(8-12)5-4-9(2)13-7-6-11/h3-5,13H,2,6-7,11H2,1H3/b5-4-,10-3+.
What are the key properties of (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile?
(2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile has a molecular weight of 177.25 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-5-(2-aminoethylamino)-2-ethylidenehexa-3,5-dienenitrile is sourced from PubChem (CID 89057244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).