C10H14N2O — CID 89057326
(4E,6Z)-7-amino-4-ethenyl-N-methylhepta-2,4,6-trienamide (PubChem CID 89057326) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (4E,6Z)-7-amino-4-ethenyl-N-methylhepta-2,4,6-trienamide.
| Compound Name | (4E,6Z)-7-amino-4-ethenyl-N-methylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 89057326 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (4E,6Z)-7-amino-4-ethenyl-N-methylhepta-2,4,6-trienamide |
| SMILES | C=C/C(C=CC(=O)NC)=C\C=C/N |
| InChI | InChI=1S/C10H14N2O/c1-3-9(5-4-8-11)6-7-10(13)12-2/h3-8H,1,11H2,2H3,(H,12,13)/b7-6?,8-4-,9-5+ |
| InChIKey | VHGFAPUZKJBRRH-KVFCXGBASA-N |
| XLogP | 0.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|