C21H24Cl2N6O4 — CID 89057500
[(3S)-1-[N-cyano-N'-[(2S)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]-3-oxopropyl]carbamimidoyl]pyrrolidin-3-yl] acetate (PubChem CID 89057500) has the molecular formula C21H24Cl2N6O4 and a molecular weight of 495.37 g/mol. Its IUPAC name is [(3S)-1-[N-cyano-N'-[(2S)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]-3-oxopropyl]carbamimidoyl]pyrrolidin-3-yl] acetate.
| Compound Name | [(3S)-1-[N-cyano-N'-[(2S)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]-3-oxopropyl]carbamimidoyl]pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 89057500 |
| Molecular Formula | C21H24Cl2N6O4 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | [(3S)-1-[N-cyano-N'-[(2S)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]-3-oxopropyl]carbamimidoyl]pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCN(/C(=N/C[C@@H](C=O)NC(=O)c2c(Cl)cc3c(c2Cl)CCNC3)NC#N)C1 |
| InChI | InChI=1S/C21H24Cl2N6O4/c1-12(31)33-15-3-5-29(9-15)21(27-11-24)26-8-14(10-30)28-20(32)18-17(22)6-13-7-25-4-2-16(13)19(18)23/h6,10,14-15,25H,2-5,7-9H2,1H3,(H,26,27)(H,28,32)/t14-,15-/m0/s1 |
| InChIKey | XNGKBMQSKYEZBC-GJZGRUSLSA-N |
| XLogP | 1.00 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|