C44H24N6 — CID 89057621
4-[14-(4-cyanophenyl)-5,15-diphenyl-3,5,13,15-tetrazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(21),2(6),3,7,9,11(22),12(16),13,17,19-decaen-4-yl]benzonitrile (PubChem CID 89057621) has the molecular formula C44H24N6 and a molecular weight of 636.72 g/mol. Its IUPAC name is 4-[14-(4-cyanophenyl)-5,15-diphenyl-3,5,13,15-tetrazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(21),2(6),3,7,9,11(22),12(16),13,17,19-decaen-4-yl]benzonitrile.
| Compound Name | 4-[14-(4-cyanophenyl)-5,15-diphenyl-3,5,13,15-tetrazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(21),2(6),3,7,9,11(22),12(16),13,17,19-decaen-4-yl]benzonitrile |
|---|---|
| PubChem CID | 89057621 |
| Molecular Formula | C44H24N6 |
| Molecular Weight | 636.72 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 4-[14-(4-cyanophenyl)-5,15-diphenyl-3,5,13,15-tetrazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(21),2(6),3,7,9,11(22),12(16),13,17,19-decaen-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3c4cccc5c4c4c(cccc4c3n2-c2ccccc2)c2nc(-c3ccc(C#N)cc3)n(-c3ccccc3)c52)cc1 |
| InChI | InChI=1S/C44H24N6/c45-25-27-17-21-29(22-18-27)43-47-39-33-13-8-16-36-38(33)37-34(14-7-15-35(37)41(39)49(43)31-9-3-1-4-10-31)40-42(36)50(32-11-5-2-6-12-32)44(48-40)30-23-19-28(26-46)20-24-30/h1-24H |
| InChIKey | IQAHUVZHXJRWRD-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 83.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.72 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|