C32H10N8 — CID 89057623
3,10,18,25-tetrazaoctacyclo[14.14.2.02,11.04,9.012,32.017,26.019,24.027,31]dotriaconta-1(31),2,4(9),5,7,10,12(32),13,15,17,19(24),20,22,25,27,29-hexadecaene-6,7,21,22-tetracarbonitrile (PubChem CID 89057623) has the molecular formula C32H10N8 and a molecular weight of 506.49 g/mol. Its IUPAC name is 3,10,18,25-tetrazaoctacyclo[14.14.2.02,11.04,9.012,32.017,26.019,24.027,31]dotriaconta-1(31),2,4(9),5,7,10,12(32),13,15,17,19(24),20,22,25,27,29-hexadecaene-6,7,21,22-tetracarbonitrile.
| Compound Name | 3,10,18,25-tetrazaoctacyclo[14.14.2.02,11.04,9.012,32.017,26.019,24.027,31]dotriaconta-1(31),2,4(9),5,7,10,12(32),13,15,17,19(24),20,22,25,27,29-hexadecaene-6,7,21,22-tetracarbonitrile |
|---|---|
| PubChem CID | 89057623 |
| Molecular Formula | C32H10N8 |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 3,10,18,25-tetrazaoctacyclo[14.14.2.02,11.04,9.012,32.017,26.019,24.027,31]dotriaconta-1(31),2,4(9),5,7,10,12(32),13,15,17,19(24),20,22,25,27,29-hexadecaene-6,7,21,22-tetracarbonitrile |
| SMILES | N#Cc1cc2nc3c4cccc5c6nc7cc(C#N)c(C#N)cc7nc6c6cccc(c3nc2cc1C#N)c6c45 |
| InChI | InChI=1S/C32H10N8/c33-11-15-7-23-25(9-17(15)13-35)39-31-21-5-2-6-22-28(21)27-19(29(31)37-23)3-1-4-20(27)30-32(22)40-26-10-18(14-36)16(12-34)8-24(26)38-30/h1-10H |
| InChIKey | MOJCVECQCHWIHR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|