C16H26O2 — CID 89057756
(5E,7Z)-8-methyl-7-(2-methylbutan-2-yl)deca-5,7-diene-2,4-dione (PubChem CID 89057756) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (5E,7Z)-8-methyl-7-(2-methylbutan-2-yl)deca-5,7-diene-2,4-dione.
| Compound Name | (5E,7Z)-8-methyl-7-(2-methylbutan-2-yl)deca-5,7-diene-2,4-dione |
|---|---|
| PubChem CID | 89057756 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (5E,7Z)-8-methyl-7-(2-methylbutan-2-yl)deca-5,7-diene-2,4-dione |
| SMILES | CC/C(C)=C(/C=C/C(=O)CC(C)=O)C(C)(C)CC |
| InChI | InChI=1S/C16H26O2/c1-7-12(3)15(16(5,6)8-2)10-9-14(18)11-13(4)17/h9-10H,7-8,11H2,1-6H3/b10-9+,15-12- |
| InChIKey | BHHSYDCNVMRJDZ-ADCBRGLKSA-N |
| XLogP | 4.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|