C10H11FO4 — CID 89058206
8-fluoro-5-methoxy-2,3,7,8-tetrahydro-1,4-benzodioxine-7-carbaldehyde (PubChem CID 89058206) has the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. Its IUPAC name is 8-fluoro-5-methoxy-2,3,7,8-tetrahydro-1,4-benzodioxine-7-carbaldehyde.
| Compound Name | 8-fluoro-5-methoxy-2,3,7,8-tetrahydro-1,4-benzodioxine-7-carbaldehyde |
|---|---|
| PubChem CID | 89058206 |
| Molecular Formula | C10H11FO4 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 8-fluoro-5-methoxy-2,3,7,8-tetrahydro-1,4-benzodioxine-7-carbaldehyde |
| SMILES | COC1=CC(C=O)C(F)C2=C1OCCO2 |
| InChI | InChI=1S/C10H11FO4/c1-13-7-4-6(5-12)8(11)10-9(7)14-2-3-15-10/h4-6,8H,2-3H2,1H3 |
| InChIKey | YFGBDFUFGIYCFD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|