C8H12FNO2S — CID 89058341
(2E,4Z)-6-fluoro-N-methylhepta-2,4,6-triene-3-sulfonamide (PubChem CID 89058341) has the molecular formula C8H12FNO2S and a molecular weight of 205.25 g/mol. Its IUPAC name is (2E,4Z)-6-fluoro-N-methylhepta-2,4,6-triene-3-sulfonamide.
| Compound Name | (2E,4Z)-6-fluoro-N-methylhepta-2,4,6-triene-3-sulfonamide |
|---|---|
| PubChem CID | 89058341 |
| Molecular Formula | C8H12FNO2S |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (2E,4Z)-6-fluoro-N-methylhepta-2,4,6-triene-3-sulfonamide |
| SMILES | C=C(F)/C=C\C(=C/C)S(=O)(=O)NC |
| InChI | InChI=1S/C8H12FNO2S/c1-4-8(6-5-7(2)9)13(11,12)10-3/h4-6,10H,2H2,1,3H3/b6-5-,8-4+ |
| InChIKey | KWCJDRXLPVZNIH-QNMAEOQASA-N |
| XLogP | 1.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|