C32H31IN2O5 — CID 89058530
2-[1-[2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazol-1-yl]-2-methylpropyl]-7-(iodomethyl)-3-[(3-methoxyphenyl)methyl]chromen-4-one (PubChem CID 89058530) has the molecular formula C32H31IN2O5 and a molecular weight of 650.51 g/mol. Its IUPAC name is 2-[1-[2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazol-1-yl]-2-methylpropyl]-7-(iodomethyl)-3-[(3-methoxyphenyl)methyl]chromen-4-one.
| Compound Name | 2-[1-[2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazol-1-yl]-2-methylpropyl]-7-(iodomethyl)-3-[(3-methoxyphenyl)methyl]chromen-4-one |
|---|---|
| PubChem CID | 89058530 |
| Molecular Formula | C32H31IN2O5 |
| Molecular Weight | 650.51 g/mol |
| Exact Mass | 650.13 |
| IUPAC Name | 2-[1-[2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazol-1-yl]-2-methylpropyl]-7-(iodomethyl)-3-[(3-methoxyphenyl)methyl]chromen-4-one |
| SMILES | COc1cccc(Cc2c(C(C(C)C)N3CCN=C3c3ccc4c(c3)OCO4)oc3cc(CI)ccc3c2=O)c1 |
| InChI | InChI=1S/C32H31IN2O5/c1-19(2)29(35-12-11-34-32(35)22-8-10-26-28(16-22)39-18-38-26)31-25(14-20-5-4-6-23(13-20)37-3)30(36)24-9-7-21(17-33)15-27(24)40-31/h4-10,13,15-16,19,29H,11-12,14,17-18H2,1-3H3 |
| InChIKey | NPOQFPOYKAKPQW-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 73.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|