C23H27ClN4O4S — CID 89058583
1-(3-aminophenyl)sulfonyl-6-[(4-chlorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 89058583) has the molecular formula C23H27ClN4O4S and a molecular weight of 491.01 g/mol. Its IUPAC name is 1-(3-aminophenyl)sulfonyl-6-[(4-chlorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 1-(3-aminophenyl)sulfonyl-6-[(4-chlorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 89058583 |
| Molecular Formula | C23H27ClN4O4S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 1-(3-aminophenyl)sulfonyl-6-[(4-chlorophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC(C)N1CC2N(C(=O)CCN2S(=O)(=O)c2cccc(N)c2)C(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C23H27ClN4O4S/c1-15(2)26-14-21-27(33(31,32)19-5-3-4-18(25)13-19)11-10-22(29)28(21)20(23(26)30)12-16-6-8-17(24)9-7-16/h3-9,13,15,20-21H,10-12,14,25H2,1-2H3 |
| InChIKey | YHKPEXUJYORYJL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|