About CID 89058635
CID 89058635 (PubChem CID 89058635) has the molecular formula C18H20BNO4
and a molecular weight of 325.17 g/mol.
Molecular Properties
| Compound Name | CID 89058635 |
| PubChem CID | 89058635 |
| Molecular Formula | C18H20BNO4 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | — |
| SMILES | [B]c1cc(OC)c(O)cc1CC1C2=C(CCN1C=O)CC(=O)CC2 |
| InChI | InChI=1S/C18H20BNO4/c1-24-18-9-15(19)12(8-17(18)23)7-16-14-3-2-13(22)6-11(14)4-5-20(16)10-21/h8-10,16,23H,2-7H2,1H3 |
| InChIKey | NNAVVDQPBRVPPJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 89058635 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89058635?
The IUPAC name of CID 89058635 (CID 89058635) is not available.
What is the SMILES notation for CID 89058635?
The canonical SMILES for CID 89058635 is [B]c1cc(OC)c(O)cc1CC1C2=C(CCN1C=O)CC(=O)CC2.
What is the InChIKey of CID 89058635?
The InChIKey is NNAVVDQPBRVPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BNO4/c1-24-18-9-15(19)12(8-17(18)23)7-16-14-3-2-13(22)6-11(14)4-5-20(16)10-21/h8-10,16,23H,2-7H2,1H3.
What are the key properties of CID 89058635?
CID 89058635 has a molecular weight of 325.17 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89058635 is sourced from PubChem (CID 89058635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).