About (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate
(1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate (PubChem CID 89058651) has the molecular formula C19H32O3
and a molecular weight of 308.46 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate.
Molecular Properties
| Compound Name | (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate |
| PubChem CID | 89058651 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate |
| SMILES | C=CCC(C)/C(C)=C\COCC(=O)OC1(CC)CCCCC1 |
| InChI | InChI=1S/C19H32O3/c1-5-10-16(3)17(4)11-14-21-15-18(20)22-19(6-2)12-8-7-9-13-19/h5,11,16H,1,6-10,12-15H2,2-4H3/b17-11- |
| InChIKey | FRWOFAAFDPKJPZ-BOPFTXTBSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate?
The IUPAC name of (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate (CID 89058651) is (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate.
What is the SMILES notation for (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate?
The canonical SMILES for (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate is C=CCC(C)/C(C)=C\COCC(=O)OC1(CC)CCCCC1.
What is the InChIKey of (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate?
The InChIKey is FRWOFAAFDPKJPZ-BOPFTXTBSA-N. The full InChI is InChI=1S/C19H32O3/c1-5-10-16(3)17(4)11-14-21-15-18(20)22-19(6-2)12-8-7-9-13-19/h5,11,16H,1,6-10,12-15H2,2-4H3/b17-11-.
What are the key properties of (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate?
(1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate has a molecular weight of 308.46 g/mol, XLogP of 4.82, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclohexyl) 2-[(2Z)-3,4-dimethylhepta-2,6-dienoxy]acetate is sourced from PubChem (CID 89058651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).