C21H33ClO3S — CID 89058907
methyl 2-[4-[(1R,2S,3R,5R)-5-chloro-2-(3-cyclohexylprop-1-ynyl)-3-hydroxycyclopentyl]butylsulfanyl]acetate (PubChem CID 89058907) has the molecular formula C21H33ClO3S and a molecular weight of 401.01 g/mol. Its IUPAC name is methyl 2-[4-[(1R,2S,3R,5R)-5-chloro-2-(3-cyclohexylprop-1-ynyl)-3-hydroxycyclopentyl]butylsulfanyl]acetate.
| Compound Name | methyl 2-[4-[(1R,2S,3R,5R)-5-chloro-2-(3-cyclohexylprop-1-ynyl)-3-hydroxycyclopentyl]butylsulfanyl]acetate |
|---|---|
| PubChem CID | 89058907 |
| Molecular Formula | C21H33ClO3S |
| Molecular Weight | 401.01 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | methyl 2-[4-[(1R,2S,3R,5R)-5-chloro-2-(3-cyclohexylprop-1-ynyl)-3-hydroxycyclopentyl]butylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCC[C@@H]1[C@@H](C#CCC2CCCCC2)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C21H33ClO3S/c1-25-21(24)15-26-13-6-5-11-17-18(20(23)14-19(17)22)12-7-10-16-8-3-2-4-9-16/h16-20,23H,2-6,8-11,13-15H2,1H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | KLEYZZHLAZASAF-UAFMIMERSA-N |
| XLogP | 4.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.01 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|