4-methylcyclohexa-1,3-diene-1-carbonyl chloride

C8H9ClO — CID 89058972

IUPAC4-methylcyclohexa-1,3-diene-1-carbonyl chloride
SMILESCC1=CC=C(C(=O)Cl)CC1
InChIInChI=1S/C8H9ClO/c1-6-2-4-7(5-3-6)8(9)10/h2,4H,3,5H2,1H3
InChIKeyVJUQQDCLLVGWMG-UHFFFAOYSA-N
MW156.61 g/mol
LogP2.42
Rot. Bonds1

About 4-methylcyclohexa-1,3-diene-1-carbonyl chloride

4-methylcyclohexa-1,3-diene-1-carbonyl chloride (PubChem CID 89058972) has the molecular formula C8H9ClO and a molecular weight of 156.61 g/mol. Its IUPAC name is 4-methylcyclohexa-1,3-diene-1-carbonyl chloride.

Molecular Properties

Compound Name4-methylcyclohexa-1,3-diene-1-carbonyl chloride
PubChem CID89058972
Molecular FormulaC8H9ClO
Molecular Weight156.61 g/mol
Exact Mass156.03
IUPAC Name4-methylcyclohexa-1,3-diene-1-carbonyl chloride
SMILESCC1=CC=C(C(=O)Cl)CC1
InChIInChI=1S/C8H9ClO/c1-6-2-4-7(5-3-6)8(9)10/h2,4H,3,5H2,1H3
InChIKeyVJUQQDCLLVGWMG-UHFFFAOYSA-N
XLogP2.42
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.61
LogP ≤ 52.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-methylcyclohexa-1,3-diene-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylcyclohexa-1,3-diene-1-carbonyl chloride?
The IUPAC name of 4-methylcyclohexa-1,3-diene-1-carbonyl chloride (CID 89058972) is 4-methylcyclohexa-1,3-diene-1-carbonyl chloride.
What is the SMILES notation for 4-methylcyclohexa-1,3-diene-1-carbonyl chloride?
The canonical SMILES for 4-methylcyclohexa-1,3-diene-1-carbonyl chloride is CC1=CC=C(C(=O)Cl)CC1.
What is the InChIKey of 4-methylcyclohexa-1,3-diene-1-carbonyl chloride?
The InChIKey is VJUQQDCLLVGWMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO/c1-6-2-4-7(5-3-6)8(9)10/h2,4H,3,5H2,1H3.
What are the key properties of 4-methylcyclohexa-1,3-diene-1-carbonyl chloride?
4-methylcyclohexa-1,3-diene-1-carbonyl chloride has a molecular weight of 156.61 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohexa-1,3-diene-1-carbonyl chloride is sourced from PubChem (CID 89058972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).