C26H36N6O8S — CID 89059007
tert-butyl N-[(1S)-2-methyl-1-[4-[5-methyl-4-[[(1S)-1-[4-(2-methylperoxyethylcarbamoyl)-1,3-oxazol-2-yl]ethyl]carbamoyl]-1,3-oxazol-2-yl]-1,3-thiazol-2-yl]propyl]carbamate (PubChem CID 89059007) has the molecular formula C26H36N6O8S and a molecular weight of 592.68 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-methyl-1-[4-[5-methyl-4-[[(1S)-1-[4-(2-methylperoxyethylcarbamoyl)-1,3-oxazol-2-yl]ethyl]carbamoyl]-1,3-oxazol-2-yl]-1,3-thiazol-2-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-methyl-1-[4-[5-methyl-4-[[(1S)-1-[4-(2-methylperoxyethylcarbamoyl)-1,3-oxazol-2-yl]ethyl]carbamoyl]-1,3-oxazol-2-yl]-1,3-thiazol-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 89059007 |
| Molecular Formula | C26H36N6O8S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | tert-butyl N-[(1S)-2-methyl-1-[4-[5-methyl-4-[[(1S)-1-[4-(2-methylperoxyethylcarbamoyl)-1,3-oxazol-2-yl]ethyl]carbamoyl]-1,3-oxazol-2-yl]-1,3-thiazol-2-yl]propyl]carbamate |
| SMILES | COOCCNC(=O)c1coc([C@H](C)NC(=O)c2nc(-c3csc([C@@H](NC(=O)OC(C)(C)C)C(C)C)n3)oc2C)n1 |
| InChI | InChI=1S/C26H36N6O8S/c1-13(2)18(32-25(35)40-26(5,6)7)24-30-17(12-41-24)23-31-19(15(4)39-23)21(34)28-14(3)22-29-16(11-37-22)20(33)27-9-10-38-36-8/h11-14,18H,9-10H2,1-8H3,(H,27,33)(H,28,34)(H,32,35)/t14-,18-/m0/s1 |
| InChIKey | DKLOYAUNNAHDPY-KSSFIOAISA-N |
| XLogP | 4.12 |
| TPSA | 179.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|