About 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid
5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 89059061) has the molecular formula C20H25N5O4
and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid |
| PubChem CID | 89059061 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | CC(CN)N(c1ccc(/N=N/c2cc(C(=O)O)cc(C(=O)O)c2)cc1)C(C)CN |
| InChI | InChI=1S/C20H25N5O4/c1-12(10-21)25(13(2)11-22)18-5-3-16(4-6-18)23-24-17-8-14(19(26)27)7-15(9-17)20(28)29/h3-9,12-13H,10-11,21-22H2,1-2H3,(H,26,27)(H,28,29)/b24-23+ |
| InChIKey | JNEZKXGYWBWNBW-WCWDXBQESA-N |
| XLogP | 3.00 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid?
The IUPAC name of 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid (CID 89059061) is 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid is CC(CN)N(c1ccc(/N=N/c2cc(C(=O)O)cc(C(=O)O)c2)cc1)C(C)CN.
What is the InChIKey of 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid?
The InChIKey is JNEZKXGYWBWNBW-WCWDXBQESA-N. The full InChI is InChI=1S/C20H25N5O4/c1-12(10-21)25(13(2)11-22)18-5-3-16(4-6-18)23-24-17-8-14(19(26)27)7-15(9-17)20(28)29/h3-9,12-13H,10-11,21-22H2,1-2H3,(H,26,27)(H,28,29)/b24-23+.
What are the key properties of 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid?
5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid has a molecular weight of 399.45 g/mol, XLogP of 3.00, 9 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-[bis(1-aminopropan-2-yl)amino]phenyl]diazenyl]benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 89059061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).