C20H28O4 — CID 89059125
(5E,7S,9R,11E,13R,14R)-14-ethyl-5,7,9,13-tetramethyl-3-methylidene-1-oxacyclotetradeca-5,11-diene-2,4,10-trione (PubChem CID 89059125) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (5E,7S,9R,11E,13R,14R)-14-ethyl-5,7,9,13-tetramethyl-3-methylidene-1-oxacyclotetradeca-5,11-diene-2,4,10-trione.
| Compound Name | (5E,7S,9R,11E,13R,14R)-14-ethyl-5,7,9,13-tetramethyl-3-methylidene-1-oxacyclotetradeca-5,11-diene-2,4,10-trione |
|---|---|
| PubChem CID | 89059125 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (5E,7S,9R,11E,13R,14R)-14-ethyl-5,7,9,13-tetramethyl-3-methylidene-1-oxacyclotetradeca-5,11-diene-2,4,10-trione |
| SMILES | C=C1C(=O)O[C@H](CC)[C@H](C)/C=C/C(=O)[C@H](C)C[C@H](C)/C=C(\C)C1=O |
| InChI | InChI=1S/C20H28O4/c1-7-18-13(3)8-9-17(21)14(4)10-12(2)11-15(5)19(22)16(6)20(23)24-18/h8-9,11-14,18H,6-7,10H2,1-5H3/b9-8+,15-11+/t12-,13+,14+,18+/m0/s1 |
| InChIKey | LLFTVLSVCZVKGJ-AZSAVZIESA-N |
| XLogP | 3.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|