C18H23N3O2S — CID 8905918
2-[ethyl-[2-(3-methylanilino)-2-oxoethyl]amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 8905918) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 2-[ethyl-[2-(3-methylanilino)-2-oxoethyl]amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[ethyl-[2-(3-methylanilino)-2-oxoethyl]amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 8905918 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-[ethyl-[2-(3-methylanilino)-2-oxoethyl]amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCN(CC(=O)NCc1cccs1)CC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C18H23N3O2S/c1-3-21(12-17(22)19-11-16-8-5-9-24-16)13-18(23)20-15-7-4-6-14(2)10-15/h4-10H,3,11-13H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | VESDFSQDPJHHJJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |