About 1-cyclopentyl-3,3-dimethylbutan-1-imine
1-cyclopentyl-3,3-dimethylbutan-1-imine (PubChem CID 89059195) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 1-cyclopentyl-3,3-dimethylbutan-1-imine.
Molecular Properties
| Compound Name | 1-cyclopentyl-3,3-dimethylbutan-1-imine |
| PubChem CID | 89059195 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 1-cyclopentyl-3,3-dimethylbutan-1-imine |
| SMILES | [H]/N=C(\CC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C11H21N/c1-11(2,3)8-10(12)9-6-4-5-7-9/h9,12H,4-8H2,1-3H3/b12-10+ |
| InChIKey | HPOJZVZDPAWPHP-ZRDIBKRKSA-N |
| XLogP | 3.63 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-3,3-dimethylbutan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3,3-dimethylbutan-1-imine?
The IUPAC name of 1-cyclopentyl-3,3-dimethylbutan-1-imine (CID 89059195) is 1-cyclopentyl-3,3-dimethylbutan-1-imine.
What is the SMILES notation for 1-cyclopentyl-3,3-dimethylbutan-1-imine?
The canonical SMILES for 1-cyclopentyl-3,3-dimethylbutan-1-imine is [H]/N=C(\CC(C)(C)C)C1CCCC1.
What is the InChIKey of 1-cyclopentyl-3,3-dimethylbutan-1-imine?
The InChIKey is HPOJZVZDPAWPHP-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H21N/c1-11(2,3)8-10(12)9-6-4-5-7-9/h9,12H,4-8H2,1-3H3/b12-10+.
What are the key properties of 1-cyclopentyl-3,3-dimethylbutan-1-imine?
1-cyclopentyl-3,3-dimethylbutan-1-imine has a molecular weight of 167.30 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3,3-dimethylbutan-1-imine is sourced from PubChem (CID 89059195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).