C24H29NO3 — CID 89059326
2-[(1-benzyl-2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-yl)-dideuteriomethyl]-4,7-dideuterio-5,6-bis(trideuteriomethoxy)-2,3-dihydroinden-1-one (PubChem CID 89059326) has the molecular formula C24H29NO3 and a molecular weight of 398.62 g/mol. Its IUPAC name is 2-[(1-benzyl-2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-yl)-dideuteriomethyl]-4,7-dideuterio-5,6-bis(trideuteriomethoxy)-2,3-dihydroinden-1-one.
| Compound Name | 2-[(1-benzyl-2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-yl)-dideuteriomethyl]-4,7-dideuterio-5,6-bis(trideuteriomethoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 89059326 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | 2-[(1-benzyl-2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-yl)-dideuteriomethyl]-4,7-dideuterio-5,6-bis(trideuteriomethoxy)-2,3-dihydroinden-1-one |
| SMILES | [2H]c1c2c(c([2H])c(OC([2H])([2H])[2H])c1OC([2H])([2H])[2H])C(=O)C(C([2H])([2H])C1([2H])C([2H])([2H])C([2H])([2H])N(Cc3ccccc3)C([2H])([2H])C1([2H])[2H])C2 |
| InChI | InChI=1S/C24H29NO3/c1-27-22-14-19-13-20(24(26)21(19)15-23(22)28-2)12-17-8-10-25(11-9-17)16-18-6-4-3-5-7-18/h3-7,14-15,17,20H,8-13,16H2,1-2H3/i1D3,2D3,8D2,9D2,10D2,11D2,12D2,14D,15D,17D |
| InChIKey | ADEBPBSSDYVVLD-KPWXCJHCSA-N |
| XLogP | 4.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |