About (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol
(3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol (PubChem CID 89059394) has the molecular formula C17H31NO
and a molecular weight of 265.44 g/mol. Its IUPAC name is (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol.
Molecular Properties
| Compound Name | (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol |
| PubChem CID | 89059394 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol |
| SMILES | C=C1C(C)C(=C)N(C(C)CCCCCCC)C[C@@H]1O |
| InChI | InChI=1S/C17H31NO/c1-6-7-8-9-10-11-13(2)18-12-17(19)15(4)14(3)16(18)5/h13-14,17,19H,4-12H2,1-3H3/t13?,14?,17-/m0/s1 |
| InChIKey | YRXFAQTYGHCTRG-KVULBXGLSA-N |
| XLogP | 4.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol?
The IUPAC name of (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol (CID 89059394) is (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol.
What is the SMILES notation for (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol?
The canonical SMILES for (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol is C=C1C(C)C(=C)N(C(C)CCCCCCC)C[C@@H]1O.
What is the InChIKey of (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol?
The InChIKey is YRXFAQTYGHCTRG-KVULBXGLSA-N. The full InChI is InChI=1S/C17H31NO/c1-6-7-8-9-10-11-13(2)18-12-17(19)15(4)14(3)16(18)5/h13-14,17,19H,4-12H2,1-3H3/t13?,14?,17-/m0/s1.
What are the key properties of (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol?
(3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol has a molecular weight of 265.44 g/mol, XLogP of 4.12, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-methyl-4,6-dimethylidene-1-nonan-2-ylpiperidin-3-ol is sourced from PubChem (CID 89059394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).