C25H25N5O4 — CID 89059625
4,4-dideuterio-6-[4-(3,3-dideuterio-2-oxopiperidin-1-yl)phenyl]-7-oxo-1-(2,3,5,6-tetradeuterio-4-methoxyphenyl)-5H-pyrazolo[5,4-c]pyridine-3-carboxamide (PubChem CID 89059625) has the molecular formula C25H25N5O4 and a molecular weight of 467.55 g/mol. Its IUPAC name is 4,4-dideuterio-6-[4-(3,3-dideuterio-2-oxopiperidin-1-yl)phenyl]-7-oxo-1-(2,3,5,6-tetradeuterio-4-methoxyphenyl)-5H-pyrazolo[5,4-c]pyridine-3-carboxamide.
| Compound Name | 4,4-dideuterio-6-[4-(3,3-dideuterio-2-oxopiperidin-1-yl)phenyl]-7-oxo-1-(2,3,5,6-tetradeuterio-4-methoxyphenyl)-5H-pyrazolo[5,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89059625 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 4,4-dideuterio-6-[4-(3,3-dideuterio-2-oxopiperidin-1-yl)phenyl]-7-oxo-1-(2,3,5,6-tetradeuterio-4-methoxyphenyl)-5H-pyrazolo[5,4-c]pyridine-3-carboxamide |
| SMILES | [2H]c1c([2H])c(-n2nc(C(N)=O)c3c2C(=O)N(c2ccc(N4CCCC([2H])([2H])C4=O)cc2)CC3([2H])[2H])c([2H])c([2H])c1OC |
| InChI | InChI=1S/C25H25N5O4/c1-34-19-11-9-18(10-12-19)30-23-20(22(27-30)24(26)32)13-15-29(25(23)33)17-7-5-16(6-8-17)28-14-3-2-4-21(28)31/h5-12H,2-4,13-15H2,1H3,(H2,26,32)/i4D2,9D,10D,11D,12D,13D2 |
| InChIKey | QNZCBYKSOIHPEH-IPDVIYOFSA-N |
| XLogP | 2.70 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |