C15H25NO18S2 — CID 89059765
(3S,4S,6R)-6-[(2S,4R,5S)-3-acetamido-2-methoxy-6-(sulfooxymethyl)-5-(trioxidanylsulfanyloxy)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 89059765) has the molecular formula C15H25NO18S2 and a molecular weight of 571.49 g/mol. Its IUPAC name is (3S,4S,6R)-6-[(2S,4R,5S)-3-acetamido-2-methoxy-6-(sulfooxymethyl)-5-(trioxidanylsulfanyloxy)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3S,4S,6R)-6-[(2S,4R,5S)-3-acetamido-2-methoxy-6-(sulfooxymethyl)-5-(trioxidanylsulfanyloxy)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 89059765 |
| Molecular Formula | C15H25NO18S2 |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | (3S,4S,6R)-6-[(2S,4R,5S)-3-acetamido-2-methoxy-6-(sulfooxymethyl)-5-(trioxidanylsulfanyloxy)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CO[C@H]1OC(COS(=O)(=O)O)[C@@H](OSOOO)[C@H](O[C@@H]2OC(C(=O)O)[C@@H](O)[C@H](O)C2O)C1NC(C)=O |
| InChI | InChI=1S/C15H25NO18S2/c1-4(17)16-6-11(30-15-9(20)7(18)8(19)12(31-15)13(21)22)10(32-35-34-33-23)5(29-14(6)27-2)3-28-36(24,25)26/h5-12,14-15,18-20,23H,3H2,1-2H3,(H,16,17)(H,21,22)(H,24,25,26)/t5?,6?,7-,8-,9?,10+,11+,12?,14-,15+/m0/s1 |
| InChIKey | YNRORNPAWKWTBE-AJIXXCPISA-N |
| XLogP | -3.67 |
| TPSA | 275.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|