C24H42F6O2Si — CID 89059879
6-[(1R,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)heptan-2-ol (PubChem CID 89059879) has the molecular formula C24H42F6O2Si and a molecular weight of 504.67 g/mol. Its IUPAC name is 6-[(1R,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)heptan-2-ol.
| Compound Name | 6-[(1R,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)heptan-2-ol |
|---|---|
| PubChem CID | 89059879 |
| Molecular Formula | C24H42F6O2Si |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 6-[(1R,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)heptan-2-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@@]2(C)C1CC[C@@H]2C(C)CCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H42F6O2Si/c1-6-33(7-2,8-3)32-20-12-10-15-21(5)18(13-14-19(20)21)17(4)11-9-16-22(31,23(25,26)27)24(28,29)30/h17-20,31H,6-16H2,1-5H3/t17?,18-,19?,20+,21-/m1/s1 |
| InChIKey | ODGDBKGHXWWAQX-YCHQTSKFSA-N |
| XLogP | 8.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|