About (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine
(Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine (PubChem CID 89060119) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine.
Molecular Properties
| Compound Name | (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine |
| PubChem CID | 89060119 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine |
| SMILES | CCC(C)C/C=C(C)/C=N\N |
| InChI | InChI=1S/C9H18N2/c1-4-8(2)5-6-9(3)7-11-10/h6-8H,4-5,10H2,1-3H3/b9-6+,11-7- |
| InChIKey | OUQBBLVWUJOHDF-MLJWIXNLSA-N |
| XLogP | 2.31 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine?
The IUPAC name of (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine (CID 89060119) is (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine.
What is the SMILES notation for (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine?
The canonical SMILES for (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine is CCC(C)C/C=C(C)/C=N\N.
What is the InChIKey of (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine?
The InChIKey is OUQBBLVWUJOHDF-MLJWIXNLSA-N. The full InChI is InChI=1S/C9H18N2/c1-4-8(2)5-6-9(3)7-11-10/h6-8H,4-5,10H2,1-3H3/b9-6+,11-7-.
What are the key properties of (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine?
(Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine has a molecular weight of 154.26 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-[(E)-2,5-dimethylhept-2-enylidene]hydrazine is sourced from PubChem (CID 89060119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).