C18H34O3 — CID 89060192
1-(7-methoxy-2,4,7,9-tetramethyldec-5-en-4-yl)oxypropan-2-one (PubChem CID 89060192) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-(7-methoxy-2,4,7,9-tetramethyldec-5-en-4-yl)oxypropan-2-one.
| Compound Name | 1-(7-methoxy-2,4,7,9-tetramethyldec-5-en-4-yl)oxypropan-2-one |
|---|---|
| PubChem CID | 89060192 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 1-(7-methoxy-2,4,7,9-tetramethyldec-5-en-4-yl)oxypropan-2-one |
| SMILES | COC(C)(C=CC(C)(CC(C)C)OCC(C)=O)CC(C)C |
| InChI | InChI=1S/C18H34O3/c1-14(2)11-17(6,20-8)9-10-18(7,12-15(3)4)21-13-16(5)19/h9-10,14-15H,11-13H2,1-8H3 |
| InChIKey | CIKMEVONFUDNKF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|